C21H29FN2O4 — CID 110609370
tert-butyl 4-[2-(2-fluorophenyl)morpholine-4-carbonyl]piperidine-1-carboxylate (PubChem CID 110609370) has the molecular formula C21H29FN2O4 and a molecular weight of 392.47 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-fluorophenyl)morpholine-4-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-fluorophenyl)morpholine-4-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110609370 |
| Molecular Formula | C21H29FN2O4 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | tert-butyl 4-[2-(2-fluorophenyl)morpholine-4-carbonyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)N2CCOC(c3ccccc3F)C2)CC1 |
| InChI | InChI=1S/C21H29FN2O4/c1-21(2,3)28-20(26)23-10-8-15(9-11-23)19(25)24-12-13-27-18(14-24)16-6-4-5-7-17(16)22/h4-7,15,18H,8-14H2,1-3H3 |
| InChIKey | SJEMWVOQGTXILK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |