C20H23NO3 — CID 110612052
N-[3-(4-hydroxyphenyl)propyl]-4-(2-methylphenyl)-4-oxobutanamide (PubChem CID 110612052) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-[3-(4-hydroxyphenyl)propyl]-4-(2-methylphenyl)-4-oxobutanamide.
| Compound Name | N-[3-(4-hydroxyphenyl)propyl]-4-(2-methylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 110612052 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | N-[3-(4-hydroxyphenyl)propyl]-4-(2-methylphenyl)-4-oxobutanamide |
| SMILES | Cc1ccccc1C(=O)CCC(=O)NCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C20H23NO3/c1-15-5-2-3-7-18(15)19(23)12-13-20(24)21-14-4-6-16-8-10-17(22)11-9-16/h2-3,5,7-11,22H,4,6,12-14H2,1H3,(H,21,24) |
| InChIKey | XNNFJLLPHUQQPN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|