C25H30N2O2 — CID 110612379
1-(7,7-dimethyl-3,4,6,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-2-yl)-4-(2-methylphenyl)butane-1,4-dione (PubChem CID 110612379) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 1-(7,7-dimethyl-3,4,6,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-2-yl)-4-(2-methylphenyl)butane-1,4-dione.
| Compound Name | 1-(7,7-dimethyl-3,4,6,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-2-yl)-4-(2-methylphenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 110612379 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 1-(7,7-dimethyl-3,4,6,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-2-yl)-4-(2-methylphenyl)butane-1,4-dione |
| SMILES | Cc1ccccc1C(=O)CCC(=O)N1CCN2CC(C)(C)c3ccccc3C2C1 |
| InChI | InChI=1S/C25H30N2O2/c1-18-8-4-5-9-19(18)23(28)12-13-24(29)26-14-15-27-17-25(2,3)21-11-7-6-10-20(21)22(27)16-26/h4-11,22H,12-17H2,1-3H3 |
| InChIKey | VDMADDFCJHHSHQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |