C24H27FN2O2 — CID 110421982
1-(7,7-dimethyl-3,4,6,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-2-yl)-4-(4-fluorophenyl)butane-1,4-dione (PubChem CID 110421982) has the molecular formula C24H27FN2O2 and a molecular weight of 394.49 g/mol. Its IUPAC name is 1-(7,7-dimethyl-3,4,6,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-2-yl)-4-(4-fluorophenyl)butane-1,4-dione.
| Compound Name | 1-(7,7-dimethyl-3,4,6,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-2-yl)-4-(4-fluorophenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 110421982 |
| Molecular Formula | C24H27FN2O2 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 1-(7,7-dimethyl-3,4,6,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-2-yl)-4-(4-fluorophenyl)butane-1,4-dione |
| SMILES | CC1(C)CN2CCN(C(=O)CCC(=O)c3ccc(F)cc3)CC2c2ccccc21 |
| InChI | InChI=1S/C24H27FN2O2/c1-24(2)16-27-14-13-26(15-21(27)19-5-3-4-6-20(19)24)23(29)12-11-22(28)17-7-9-18(25)10-8-17/h3-10,21H,11-16H2,1-2H3 |
| InChIKey | ZDXZLOUHJOWAIV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |