C18H16ClNO4S — CID 110612575
1-[3-(3-chlorophenyl)sulfonylpropanoyl]-2,3-dihydroquinolin-4-one (PubChem CID 110612575) has the molecular formula C18H16ClNO4S and a molecular weight of 377.85 g/mol. Its IUPAC name is 1-[3-(3-chlorophenyl)sulfonylpropanoyl]-2,3-dihydroquinolin-4-one.
| Compound Name | 1-[3-(3-chlorophenyl)sulfonylpropanoyl]-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 110612575 |
| Molecular Formula | C18H16ClNO4S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 1-[3-(3-chlorophenyl)sulfonylpropanoyl]-2,3-dihydroquinolin-4-one |
| SMILES | O=C1CCN(C(=O)CCS(=O)(=O)c2cccc(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C18H16ClNO4S/c19-13-4-3-5-14(12-13)25(23,24)11-9-18(22)20-10-8-17(21)15-6-1-2-7-16(15)20/h1-7,12H,8-11H2 |
| InChIKey | BHROXMZKLZHCCN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |