C19H20FNO5S — CID 110613477
N-[5-(4-fluoro-3-methylbenzoyl)-2-methoxyphenyl]-3-methylsulfonylpropanamide (PubChem CID 110613477) has the molecular formula C19H20FNO5S and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[5-(4-fluoro-3-methylbenzoyl)-2-methoxyphenyl]-3-methylsulfonylpropanamide.
| Compound Name | N-[5-(4-fluoro-3-methylbenzoyl)-2-methoxyphenyl]-3-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 110613477 |
| Molecular Formula | C19H20FNO5S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | N-[5-(4-fluoro-3-methylbenzoyl)-2-methoxyphenyl]-3-methylsulfonylpropanamide |
| SMILES | COc1ccc(C(=O)c2ccc(F)c(C)c2)cc1NC(=O)CCS(C)(=O)=O |
| InChI | InChI=1S/C19H20FNO5S/c1-12-10-13(4-6-15(12)20)19(23)14-5-7-17(26-2)16(11-14)21-18(22)8-9-27(3,24)25/h4-7,10-11H,8-9H2,1-3H3,(H,21,22) |
| InChIKey | KUQUUKSNFWGDCC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |