C13H17NO4S — CID 110612634
N-(5-acetyl-2-methylphenyl)-3-methylsulfonylpropanamide (PubChem CID 110612634) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is N-(5-acetyl-2-methylphenyl)-3-methylsulfonylpropanamide.
| Compound Name | N-(5-acetyl-2-methylphenyl)-3-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 110612634 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | N-(5-acetyl-2-methylphenyl)-3-methylsulfonylpropanamide |
| SMILES | CC(=O)c1ccc(C)c(NC(=O)CCS(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H17NO4S/c1-9-4-5-11(10(2)15)8-12(9)14-13(16)6-7-19(3,17)18/h4-5,8H,6-7H2,1-3H3,(H,14,16) |
| InChIKey | FTXKSCHQEXIFDH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |