C21H26N2O3 — CID 110615920
N-[2-(2,4-dimethoxyphenyl)ethyl]-4-pyrrolidin-1-ylbenzamide (PubChem CID 110615920) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[2-(2,4-dimethoxyphenyl)ethyl]-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[2-(2,4-dimethoxyphenyl)ethyl]-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 110615920 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-[2-(2,4-dimethoxyphenyl)ethyl]-4-pyrrolidin-1-ylbenzamide |
| SMILES | COc1ccc(CCNC(=O)c2ccc(N3CCCC3)cc2)c(OC)c1 |
| InChI | InChI=1S/C21H26N2O3/c1-25-19-10-7-16(20(15-19)26-2)11-12-22-21(24)17-5-8-18(9-6-17)23-13-3-4-14-23/h5-10,15H,3-4,11-14H2,1-2H3,(H,22,24) |
| InChIKey | DJIUJPZFJIOVHU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |