C23H26N2O3 — CID 110616089
N-[4-(2-methoxyphenyl)butyl]-2-(3-methyl-2-oxo-1H-quinolin-6-yl)acetamide (PubChem CID 110616089) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is N-[4-(2-methoxyphenyl)butyl]-2-(3-methyl-2-oxo-1H-quinolin-6-yl)acetamide.
| Compound Name | N-[4-(2-methoxyphenyl)butyl]-2-(3-methyl-2-oxo-1H-quinolin-6-yl)acetamide |
|---|---|
| PubChem CID | 110616089 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | N-[4-(2-methoxyphenyl)butyl]-2-(3-methyl-2-oxo-1H-quinolin-6-yl)acetamide |
| SMILES | COc1ccccc1CCCCNC(=O)Cc1ccc2[nH]c(=O)c(C)cc2c1 |
| InChI | InChI=1S/C23H26N2O3/c1-16-13-19-14-17(10-11-20(19)25-23(16)27)15-22(26)24-12-6-5-8-18-7-3-4-9-21(18)28-2/h3-4,7,9-11,13-14H,5-6,8,12,15H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | XQNOJZBMUCWIOQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|