C20H31NO4S — CID 110617222
1-(4-cyclopentyloxy-2-methylphenyl)sulfonyl-3-(ethoxymethyl)piperidine (PubChem CID 110617222) has the molecular formula C20H31NO4S and a molecular weight of 381.54 g/mol. Its IUPAC name is 1-(4-cyclopentyloxy-2-methylphenyl)sulfonyl-3-(ethoxymethyl)piperidine.
| Compound Name | 1-(4-cyclopentyloxy-2-methylphenyl)sulfonyl-3-(ethoxymethyl)piperidine |
|---|---|
| PubChem CID | 110617222 |
| Molecular Formula | C20H31NO4S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 1-(4-cyclopentyloxy-2-methylphenyl)sulfonyl-3-(ethoxymethyl)piperidine |
| SMILES | CCOCC1CCCN(S(=O)(=O)c2ccc(OC3CCCC3)cc2C)C1 |
| InChI | InChI=1S/C20H31NO4S/c1-3-24-15-17-7-6-12-21(14-17)26(22,23)20-11-10-19(13-16(20)2)25-18-8-4-5-9-18/h10-11,13,17-18H,3-9,12,14-15H2,1-2H3 |
| InChIKey | JKAQWLJHWBWOKN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |