C21H32N2O3S — CID 110617737
3-(1,1-dioxothiolan-3-yl)-N-(3-phenyl-2-piperidin-1-ylpropyl)propanamide (PubChem CID 110617737) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-N-(3-phenyl-2-piperidin-1-ylpropyl)propanamide.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-N-(3-phenyl-2-piperidin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 110617737 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-N-(3-phenyl-2-piperidin-1-ylpropyl)propanamide |
| SMILES | O=C(CCC1CCS(=O)(=O)C1)NCC(Cc1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C21H32N2O3S/c24-21(10-9-19-11-14-27(25,26)17-19)22-16-20(23-12-5-2-6-13-23)15-18-7-3-1-4-8-18/h1,3-4,7-8,19-20H,2,5-6,9-17H2,(H,22,24) |
| InChIKey | YNWTURSZJHQLMX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |