C18H27N3O5S — CID 110618492
N-[2-[2-(diethylamino)ethoxy]ethyl]-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 110618492) has the molecular formula C18H27N3O5S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[2-[2-(diethylamino)ethoxy]ethyl]-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-[2-[2-(diethylamino)ethoxy]ethyl]-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 110618492 |
| Molecular Formula | C18H27N3O5S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-[2-[2-(diethylamino)ethoxy]ethyl]-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | CCN(CC)CCOCCNC(=O)c1ccc(N2C(=O)CCS2(=O)=O)cc1 |
| InChI | InChI=1S/C18H27N3O5S/c1-3-20(4-2)11-13-26-12-10-19-18(23)15-5-7-16(8-6-15)21-17(22)9-14-27(21,24)25/h5-8H,3-4,9-14H2,1-2H3,(H,19,23) |
| InChIKey | QZIMHSHFUBDPGL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|