C16H21ClN2O5S — CID 21007137
2-chloro-N-(3-propan-2-yloxypropyl)-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 21007137) has the molecular formula C16H21ClN2O5S and a molecular weight of 388.87 g/mol. Its IUPAC name is 2-chloro-N-(3-propan-2-yloxypropyl)-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | 2-chloro-N-(3-propan-2-yloxypropyl)-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 21007137 |
| Molecular Formula | C16H21ClN2O5S |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 2-chloro-N-(3-propan-2-yloxypropyl)-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | CC(C)OCCCNC(=O)c1ccc(N2C(=O)CCS2(=O)=O)cc1Cl |
| InChI | InChI=1S/C16H21ClN2O5S/c1-11(2)24-8-3-7-18-16(21)13-5-4-12(10-14(13)17)19-15(20)6-9-25(19,22)23/h4-5,10-11H,3,6-9H2,1-2H3,(H,18,21) |
| InChIKey | SGNJAYXJKDUQLP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|