C16H13ClN2O4S — CID 20996957
2-chloro-N-phenyl-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 20996957) has the molecular formula C16H13ClN2O4S and a molecular weight of 364.81 g/mol. Its IUPAC name is 2-chloro-N-phenyl-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | 2-chloro-N-phenyl-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 20996957 |
| Molecular Formula | C16H13ClN2O4S |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 2-chloro-N-phenyl-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(N2C(=O)CCS2(=O)=O)cc1Cl |
| InChI | InChI=1S/C16H13ClN2O4S/c17-14-10-12(19-15(20)8-9-24(19,22)23)6-7-13(14)16(21)18-11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H,18,21) |
| InChIKey | OWKCADUYXXNVMP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |