C16H12BrClN2O4S — CID 21007163
N-(2-bromophenyl)-2-chloro-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 21007163) has the molecular formula C16H12BrClN2O4S and a molecular weight of 443.71 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-chloro-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-(2-bromophenyl)-2-chloro-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 21007163 |
| Molecular Formula | C16H12BrClN2O4S |
| Molecular Weight | 443.71 g/mol |
| Exact Mass | 441.94 |
| IUPAC Name | N-(2-bromophenyl)-2-chloro-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | O=C(Nc1ccccc1Br)c1ccc(N2C(=O)CCS2(=O)=O)cc1Cl |
| InChI | InChI=1S/C16H12BrClN2O4S/c17-12-3-1-2-4-14(12)19-16(22)11-6-5-10(9-13(11)18)20-15(21)7-8-25(20,23)24/h1-6,9H,7-8H2,(H,19,22) |
| InChIKey | IGIVIGICGVMPNR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.71 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |