C16H13BrN2O4S — CID 20997199
N-(2-bromophenyl)-3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 20997199) has the molecular formula C16H13BrN2O4S and a molecular weight of 409.26 g/mol. Its IUPAC name is N-(2-bromophenyl)-3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-(2-bromophenyl)-3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 20997199 |
| Molecular Formula | C16H13BrN2O4S |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | N-(2-bromophenyl)-3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | O=C(Nc1ccccc1Br)c1cccc(N2C(=O)CCS2(=O)=O)c1 |
| InChI | InChI=1S/C16H13BrN2O4S/c17-13-6-1-2-7-14(13)18-16(21)11-4-3-5-12(10-11)19-15(20)8-9-24(19,22)23/h1-7,10H,8-9H2,(H,18,21) |
| InChIKey | YCLUDCPEJWNPCN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |