C16H25NO6S2 — CID 110619213
2-methoxy-N-methyl-5-methylsulfonyl-N-[2-(oxan-2-yl)ethyl]benzenesulfonamide (PubChem CID 110619213) has the molecular formula C16H25NO6S2 and a molecular weight of 391.51 g/mol. Its IUPAC name is 2-methoxy-N-methyl-5-methylsulfonyl-N-[2-(oxan-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-methoxy-N-methyl-5-methylsulfonyl-N-[2-(oxan-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110619213 |
| Molecular Formula | C16H25NO6S2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-methoxy-N-methyl-5-methylsulfonyl-N-[2-(oxan-2-yl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(C)(=O)=O)cc1S(=O)(=O)N(C)CCC1CCCCO1 |
| InChI | InChI=1S/C16H25NO6S2/c1-17(10-9-13-6-4-5-11-23-13)25(20,21)16-12-14(24(3,18)19)7-8-15(16)22-2/h7-8,12-13H,4-6,9-11H2,1-3H3 |
| InChIKey | WSYQEQVUMMREBY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |