C16H24ClNO2 — CID 99931540
N-[(3-chloro-4-methoxyphenyl)methyl]-N-methyl-2-[(2R)-oxan-2-yl]ethanamine (PubChem CID 99931540) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is N-[(3-chloro-4-methoxyphenyl)methyl]-N-methyl-2-[(2R)-oxan-2-yl]ethanamine.
| Compound Name | N-[(3-chloro-4-methoxyphenyl)methyl]-N-methyl-2-[(2R)-oxan-2-yl]ethanamine |
|---|---|
| PubChem CID | 99931540 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[(3-chloro-4-methoxyphenyl)methyl]-N-methyl-2-[(2R)-oxan-2-yl]ethanamine |
| SMILES | COc1ccc(CN(C)CC[C@H]2CCCCO2)cc1Cl |
| InChI | InChI=1S/C16H24ClNO2/c1-18(9-8-14-5-3-4-10-20-14)12-13-6-7-16(19-2)15(17)11-13/h6-7,11,14H,3-5,8-10,12H2,1-2H3/t14-/m1/s1 |
| InChIKey | NGASUFCSKDZLKY-CQSZACIVSA-N |
| XLogP | 3.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |