About N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]-3-phenylbutanamide
N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]-3-phenylbutanamide (PubChem CID 110621403) has the molecular formula C24H31NO4
and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]-3-phenylbutanamide.
Molecular Properties
| Compound Name | N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]-3-phenylbutanamide |
| PubChem CID | 110621403 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]-3-phenylbutanamide |
| SMILES | COc1ccc(C2(CNC(=O)CC(C)c3ccccc3)CCOCC2)cc1OC |
| InChI | InChI=1S/C24H31NO4/c1-18(19-7-5-4-6-8-19)15-23(26)25-17-24(11-13-29-14-12-24)20-9-10-21(27-2)22(16-20)28-3/h4-10,16,18H,11-15,17H2,1-3H3,(H,25,26) |
| InChIKey | NYOWMSMAFDENEF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]-3-phenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]-3-phenylbutanamide?
The IUPAC name of N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]-3-phenylbutanamide (CID 110621403) is N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]-3-phenylbutanamide.
What is the SMILES notation for N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]-3-phenylbutanamide?
The canonical SMILES for N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]-3-phenylbutanamide is COc1ccc(C2(CNC(=O)CC(C)c3ccccc3)CCOCC2)cc1OC.
What is the InChIKey of N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]-3-phenylbutanamide?
The InChIKey is NYOWMSMAFDENEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31NO4/c1-18(19-7-5-4-6-8-19)15-23(26)25-17-24(11-13-29-14-12-24)20-9-10-21(27-2)22(16-20)28-3/h4-10,16,18H,11-15,17H2,1-3H3,(H,25,26).
What are the key properties of N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]-3-phenylbutanamide?
N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]-3-phenylbutanamide has a molecular weight of 397.52 g/mol, XLogP of 4.06, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]-3-phenylbutanamide is sourced from PubChem (CID 110621403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).