C19H28N2O5 — CID 112503044
N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]morpholine-4-carboxamide (PubChem CID 112503044) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]morpholine-4-carboxamide.
| Compound Name | N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 112503044 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | N-[[4-(3,4-dimethoxyphenyl)oxan-4-yl]methyl]morpholine-4-carboxamide |
| SMILES | COc1ccc(C2(CNC(=O)N3CCOCC3)CCOCC2)cc1OC |
| InChI | InChI=1S/C19H28N2O5/c1-23-16-4-3-15(13-17(16)24-2)19(5-9-25-10-6-19)14-20-18(22)21-7-11-26-12-8-21/h3-4,13H,5-12,14H2,1-2H3,(H,20,22) |
| InChIKey | HWLOYUUXIIOONK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |