C19H23N3O3S — CID 110623293
N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-4-pyridin-3-ylbutanamide (PubChem CID 110623293) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-4-pyridin-3-ylbutanamide.
| Compound Name | N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-4-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 110623293 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-4-pyridin-3-ylbutanamide |
| SMILES | CS(=O)(=O)N1CCCc2cc(NC(=O)CCCc3cccnc3)ccc21 |
| InChI | InChI=1S/C19H23N3O3S/c1-26(24,25)22-12-4-7-16-13-17(9-10-18(16)22)21-19(23)8-2-5-15-6-3-11-20-14-15/h3,6,9-11,13-14H,2,4-5,7-8,12H2,1H3,(H,21,23) |
| InChIKey | DSNNSEDSZBMUIC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |