C22H21N3O3 — CID 110623583
N-[1-(furan-2-carbonyl)-2,3-dihydroindol-6-yl]-4-pyridin-3-ylbutanamide (PubChem CID 110623583) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[1-(furan-2-carbonyl)-2,3-dihydroindol-6-yl]-4-pyridin-3-ylbutanamide.
| Compound Name | N-[1-(furan-2-carbonyl)-2,3-dihydroindol-6-yl]-4-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 110623583 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[1-(furan-2-carbonyl)-2,3-dihydroindol-6-yl]-4-pyridin-3-ylbutanamide |
| SMILES | O=C(CCCc1cccnc1)Nc1ccc2c(c1)N(C(=O)c1ccco1)CC2 |
| InChI | InChI=1S/C22H21N3O3/c26-21(7-1-4-16-5-2-11-23-15-16)24-18-9-8-17-10-12-25(19(17)14-18)22(27)20-6-3-13-28-20/h2-3,5-6,8-9,11,13-15H,1,4,7,10,12H2,(H,24,26) |
| InChIKey | FDLNFRJBAZRBJW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |