C24H24N2O3 — CID 110303960
N-[1-(furan-2-carbonyl)-2,3-dihydroindol-6-yl]-3-methyl-3-phenylbutanamide (PubChem CID 110303960) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[1-(furan-2-carbonyl)-2,3-dihydroindol-6-yl]-3-methyl-3-phenylbutanamide.
| Compound Name | N-[1-(furan-2-carbonyl)-2,3-dihydroindol-6-yl]-3-methyl-3-phenylbutanamide |
|---|---|
| PubChem CID | 110303960 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[1-(furan-2-carbonyl)-2,3-dihydroindol-6-yl]-3-methyl-3-phenylbutanamide |
| SMILES | CC(C)(CC(=O)Nc1ccc2c(c1)N(C(=O)c1ccco1)CC2)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O3/c1-24(2,18-7-4-3-5-8-18)16-22(27)25-19-11-10-17-12-13-26(20(17)15-19)23(28)21-9-6-14-29-21/h3-11,14-15H,12-13,16H2,1-2H3,(H,25,27) |
| InChIKey | WUKQXYHIYFIIOQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |