C19H21N3O4 — CID 7687984
N-[1-(furan-2-carbonyl)-3,4-dihydro-2H-quinolin-7-yl]-N'-propan-2-yloxamide (PubChem CID 7687984) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-[1-(furan-2-carbonyl)-3,4-dihydro-2H-quinolin-7-yl]-N'-propan-2-yloxamide.
| Compound Name | N-[1-(furan-2-carbonyl)-3,4-dihydro-2H-quinolin-7-yl]-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 7687984 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[1-(furan-2-carbonyl)-3,4-dihydro-2H-quinolin-7-yl]-N'-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)Nc1ccc2c(c1)N(C(=O)c1ccco1)CCC2 |
| InChI | InChI=1S/C19H21N3O4/c1-12(2)20-17(23)18(24)21-14-8-7-13-5-3-9-22(15(13)11-14)19(25)16-6-4-10-26-16/h4,6-8,10-12H,3,5,9H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | WMIBSAIYDXCBOY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|