C16H25N3O4S2 — CID 110623316
N-(cyclopentylsulfamoyl)-1-ethylsulfonyl-3,4-dihydro-2H-quinolin-6-amine (PubChem CID 110623316) has the molecular formula C16H25N3O4S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is N-(cyclopentylsulfamoyl)-1-ethylsulfonyl-3,4-dihydro-2H-quinolin-6-amine.
| Compound Name | N-(cyclopentylsulfamoyl)-1-ethylsulfonyl-3,4-dihydro-2H-quinolin-6-amine |
|---|---|
| PubChem CID | 110623316 |
| Molecular Formula | C16H25N3O4S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-(cyclopentylsulfamoyl)-1-ethylsulfonyl-3,4-dihydro-2H-quinolin-6-amine |
| SMILES | CCS(=O)(=O)N1CCCc2cc(NS(=O)(=O)NC3CCCC3)ccc21 |
| InChI | InChI=1S/C16H25N3O4S2/c1-2-24(20,21)19-11-5-6-13-12-15(9-10-16(13)19)18-25(22,23)17-14-7-3-4-8-14/h9-10,12,14,17-18H,2-8,11H2,1H3 |
| InChIKey | YDPYZOPSGFSCMO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |