C21H25N3O3S — CID 110623260
[6-(cyclopentylsulfamoylamino)-3,4-dihydro-2H-quinolin-1-yl]-phenylmethanone (PubChem CID 110623260) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is [6-(cyclopentylsulfamoylamino)-3,4-dihydro-2H-quinolin-1-yl]-phenylmethanone.
| Compound Name | [6-(cyclopentylsulfamoylamino)-3,4-dihydro-2H-quinolin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 110623260 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | [6-(cyclopentylsulfamoylamino)-3,4-dihydro-2H-quinolin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCCc2cc(NS(=O)(=O)NC3CCCC3)ccc21 |
| InChI | InChI=1S/C21H25N3O3S/c25-21(16-7-2-1-3-8-16)24-14-6-9-17-15-19(12-13-20(17)24)23-28(26,27)22-18-10-4-5-11-18/h1-3,7-8,12-13,15,18,22-23H,4-6,9-11,14H2 |
| InChIKey | NPGGBOFRZNUEDN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |