About N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide
N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide (PubChem CID 110628574) has the molecular formula C19H23N3O2S
and a molecular weight of 357.48 g/mol. Its IUPAC name is N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide |
| PubChem CID | 110628574 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide |
| SMILES | CC(C)CC(NC(=O)C1CCC(=O)N1c1ccccc1)c1nccs1 |
| InChI | InChI=1S/C19H23N3O2S/c1-13(2)12-15(19-20-10-11-25-19)21-18(24)16-8-9-17(23)22(16)14-6-4-3-5-7-14/h3-7,10-11,13,15-16H,8-9,12H2,1-2H3,(H,21,24) |
| InChIKey | LSTOEFGNYNBVLZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide?
The IUPAC name of N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide (CID 110628574) is N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide.
What is the SMILES notation for N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide?
The canonical SMILES for N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide is CC(C)CC(NC(=O)C1CCC(=O)N1c1ccccc1)c1nccs1.
What is the InChIKey of N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide?
The InChIKey is LSTOEFGNYNBVLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O2S/c1-13(2)12-15(19-20-10-11-25-19)21-18(24)16-8-9-17(23)22(16)14-6-4-3-5-7-14/h3-7,10-11,13,15-16H,8-9,12H2,1-2H3,(H,21,24).
What are the key properties of N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide?
N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide has a molecular weight of 357.48 g/mol, XLogP of 3.54, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]-5-oxo-1-phenylpyrrolidine-2-carboxamide is sourced from PubChem (CID 110628574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).