C22H26N2O4 — CID 110629552
1-benzyl-N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-N-methyl-5-oxopyrrolidine-2-carboxamide (PubChem CID 110629552) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-benzyl-N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-N-methyl-5-oxopyrrolidine-2-carboxamide.
| Compound Name | 1-benzyl-N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-N-methyl-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110629552 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-benzyl-N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-N-methyl-5-oxopyrrolidine-2-carboxamide |
| SMILES | COc1cccc(C(O)CN(C)C(=O)C2CCC(=O)N2Cc2ccccc2)c1 |
| InChI | InChI=1S/C22H26N2O4/c1-23(15-20(25)17-9-6-10-18(13-17)28-2)22(27)19-11-12-21(26)24(19)14-16-7-4-3-5-8-16/h3-10,13,19-20,25H,11-12,14-15H2,1-2H3 |
| InChIKey | SEOYEYYPXKINKL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |