C19H23NO6S — CID 110629557
N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-methoxy-N-methyl-3-methylsulfonylbenzamide (PubChem CID 110629557) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-methoxy-N-methyl-3-methylsulfonylbenzamide.
| Compound Name | N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-methoxy-N-methyl-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 110629557 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-methoxy-N-methyl-3-methylsulfonylbenzamide |
| SMILES | COc1cccc(C(O)CN(C)C(=O)c2ccc(OC)c(S(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C19H23NO6S/c1-20(12-16(21)13-6-5-7-15(10-13)25-2)19(22)14-8-9-17(26-3)18(11-14)27(4,23)24/h5-11,16,21H,12H2,1-4H3 |
| InChIKey | PRGBTQUXWJQUQJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |