C24H25NO4 — CID 110291255
N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-N-methyl-3-phenylbenzamide (PubChem CID 110291255) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-N-methyl-3-phenylbenzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-N-methyl-3-phenylbenzamide |
|---|---|
| PubChem CID | 110291255 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-N-methyl-3-phenylbenzamide |
| SMILES | COc1ccc(C(O)CN(C)C(=O)c2cccc(-c3ccccc3)c2)cc1OC |
| InChI | InChI=1S/C24H25NO4/c1-25(16-21(26)19-12-13-22(28-2)23(15-19)29-3)24(27)20-11-7-10-18(14-20)17-8-5-4-6-9-17/h4-15,21,26H,16H2,1-3H3 |
| InChIKey | UQOHHANVTWIMLC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |