C24H30N2O5 — CID 24817343
3-(1-acetylpiperidin-4-yl)oxy-N-(2-hydroxy-2-phenylethyl)-4-methoxy-N-methylbenzamide (PubChem CID 24817343) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 3-(1-acetylpiperidin-4-yl)oxy-N-(2-hydroxy-2-phenylethyl)-4-methoxy-N-methylbenzamide.
| Compound Name | 3-(1-acetylpiperidin-4-yl)oxy-N-(2-hydroxy-2-phenylethyl)-4-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 24817343 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 3-(1-acetylpiperidin-4-yl)oxy-N-(2-hydroxy-2-phenylethyl)-4-methoxy-N-methylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)CC(O)c2ccccc2)cc1OC1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C24H30N2O5/c1-17(27)26-13-11-20(12-14-26)31-23-15-19(9-10-22(23)30-3)24(29)25(2)16-21(28)18-7-5-4-6-8-18/h4-10,15,20-21,28H,11-14,16H2,1-3H3 |
| InChIKey | BDMPTTGXGYAQDR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |