C24H36N2O4 — CID 24818955
3-(1-acetylpiperidin-4-yl)oxy-N-(3-cyclopentylpropyl)-4-methoxy-N-methylbenzamide (PubChem CID 24818955) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is 3-(1-acetylpiperidin-4-yl)oxy-N-(3-cyclopentylpropyl)-4-methoxy-N-methylbenzamide.
| Compound Name | 3-(1-acetylpiperidin-4-yl)oxy-N-(3-cyclopentylpropyl)-4-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 24818955 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 3-(1-acetylpiperidin-4-yl)oxy-N-(3-cyclopentylpropyl)-4-methoxy-N-methylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)CCCC2CCCC2)cc1OC1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C24H36N2O4/c1-18(27)26-15-12-21(13-16-26)30-23-17-20(10-11-22(23)29-3)24(28)25(2)14-6-9-19-7-4-5-8-19/h10-11,17,19,21H,4-9,12-16H2,1-3H3 |
| InChIKey | DKXMFTIBGWJXQM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |