C22H34N2O4 — CID 25491681
4-(1-cyclopentylpiperidin-4-yl)oxy-3-methoxy-N-(2-methoxyethyl)-N-methylbenzamide (PubChem CID 25491681) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is 4-(1-cyclopentylpiperidin-4-yl)oxy-3-methoxy-N-(2-methoxyethyl)-N-methylbenzamide.
| Compound Name | 4-(1-cyclopentylpiperidin-4-yl)oxy-3-methoxy-N-(2-methoxyethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 25491681 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 4-(1-cyclopentylpiperidin-4-yl)oxy-3-methoxy-N-(2-methoxyethyl)-N-methylbenzamide |
| SMILES | COCCN(C)C(=O)c1ccc(OC2CCN(C3CCCC3)CC2)c(OC)c1 |
| InChI | InChI=1S/C22H34N2O4/c1-23(14-15-26-2)22(25)17-8-9-20(21(16-17)27-3)28-19-10-12-24(13-11-19)18-6-4-5-7-18/h8-9,16,18-19H,4-7,10-15H2,1-3H3 |
| InChIKey | FDIWMNCMZUYUQV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |