C21H27NO5S — CID 18354489
N-[2-(3,4-dimethoxyphenyl)-4-methylsulfonylbutyl]-N-methylbenzamide (PubChem CID 18354489) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-4-methylsulfonylbutyl]-N-methylbenzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-4-methylsulfonylbutyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 18354489 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-4-methylsulfonylbutyl]-N-methylbenzamide |
| SMILES | COc1ccc(C(CCS(C)(=O)=O)CN(C)C(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C21H27NO5S/c1-22(21(23)16-8-6-5-7-9-16)15-18(12-13-28(4,24)25)17-10-11-19(26-2)20(14-17)27-3/h5-11,14,18H,12-13,15H2,1-4H3 |
| InChIKey | UCUFNUDOCAGGNI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |