About N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-2-(2-methoxyethoxy)ethanesulfonamide
N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-2-(2-methoxyethoxy)ethanesulfonamide (PubChem CID 110630897) has the molecular formula C14H21N3O4S
and a molecular weight of 327.41 g/mol. Its IUPAC name is N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-2-(2-methoxyethoxy)ethanesulfonamide.
Molecular Properties
| Compound Name | N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-2-(2-methoxyethoxy)ethanesulfonamide |
| PubChem CID | 110630897 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-2-(2-methoxyethoxy)ethanesulfonamide |
| SMILES | COCCOCCS(=O)(=O)NCCc1ncc2ccccn12 |
| InChI | InChI=1S/C14H21N3O4S/c1-20-8-9-21-10-11-22(18,19)16-6-5-14-15-12-13-4-2-3-7-17(13)14/h2-4,7,12,16H,5-6,8-11H2,1H3 |
| InChIKey | FIZNJGIUBQTEMC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-2-(2-methoxyethoxy)ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-2-(2-methoxyethoxy)ethanesulfonamide?
The IUPAC name of N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-2-(2-methoxyethoxy)ethanesulfonamide (CID 110630897) is N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-2-(2-methoxyethoxy)ethanesulfonamide.
What is the SMILES notation for N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-2-(2-methoxyethoxy)ethanesulfonamide?
The canonical SMILES for N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-2-(2-methoxyethoxy)ethanesulfonamide is COCCOCCS(=O)(=O)NCCc1ncc2ccccn12.
What is the InChIKey of N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-2-(2-methoxyethoxy)ethanesulfonamide?
The InChIKey is FIZNJGIUBQTEMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O4S/c1-20-8-9-21-10-11-22(18,19)16-6-5-14-15-12-13-4-2-3-7-17(13)14/h2-4,7,12,16H,5-6,8-11H2,1H3.
What are the key properties of N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-2-(2-methoxyethoxy)ethanesulfonamide?
N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-2-(2-methoxyethoxy)ethanesulfonamide has a molecular weight of 327.41 g/mol, XLogP of 0.46, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-2-(2-methoxyethoxy)ethanesulfonamide is sourced from PubChem (CID 110630897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).