About N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]propane-1-sulfonamide
N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]propane-1-sulfonamide (PubChem CID 3238358) has the molecular formula C12H17N3O2S
and a molecular weight of 267.35 g/mol. Its IUPAC name is N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]propane-1-sulfonamide.
Molecular Properties
| Compound Name | N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]propane-1-sulfonamide |
| PubChem CID | 3238358 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCc1cn2cccc(C)c2n1 |
| InChI | InChI=1S/C12H17N3O2S/c1-3-7-18(16,17)13-8-11-9-15-6-4-5-10(2)12(15)14-11/h4-6,9,13H,3,7-8H2,1-2H3 |
| InChIKey | JFXPQUICGOOPFK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]propane-1-sulfonamide?
The IUPAC name of N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]propane-1-sulfonamide (CID 3238358) is N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]propane-1-sulfonamide.
What is the SMILES notation for N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]propane-1-sulfonamide?
The canonical SMILES for N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]propane-1-sulfonamide is CCCS(=O)(=O)NCc1cn2cccc(C)c2n1.
What is the InChIKey of N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]propane-1-sulfonamide?
The InChIKey is JFXPQUICGOOPFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2S/c1-3-7-18(16,17)13-8-11-9-15-6-4-5-10(2)12(15)14-11/h4-6,9,13H,3,7-8H2,1-2H3.
What are the key properties of N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]propane-1-sulfonamide?
N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]propane-1-sulfonamide has a molecular weight of 267.35 g/mol, XLogP of 1.47, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]propane-1-sulfonamide is sourced from PubChem (CID 3238358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).