C15H18ClNO3 — CID 110631141
1-(3-chlorophenyl)-4-(3-methylmorpholin-4-yl)butane-1,4-dione (PubChem CID 110631141) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-(3-methylmorpholin-4-yl)butane-1,4-dione.
| Compound Name | 1-(3-chlorophenyl)-4-(3-methylmorpholin-4-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 110631141 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-(3-chlorophenyl)-4-(3-methylmorpholin-4-yl)butane-1,4-dione |
| SMILES | CC1COCCN1C(=O)CCC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H18ClNO3/c1-11-10-20-8-7-17(11)15(19)6-5-14(18)12-3-2-4-13(16)9-12/h2-4,9,11H,5-8,10H2,1H3 |
| InChIKey | MSYPORZFUZQPRB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |