C13H16ClNO2 — CID 62973972
1-(3-chlorophenyl)-2-(1,4-oxazepan-4-yl)ethanone (PubChem CID 62973972) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(1,4-oxazepan-4-yl)ethanone.
| Compound Name | 1-(3-chlorophenyl)-2-(1,4-oxazepan-4-yl)ethanone |
|---|---|
| PubChem CID | 62973972 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(1,4-oxazepan-4-yl)ethanone |
| SMILES | O=C(CN1CCCOCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H16ClNO2/c14-12-4-1-3-11(9-12)13(16)10-15-5-2-7-17-8-6-15/h1,3-4,9H,2,5-8,10H2 |
| InChIKey | GCHMZZOQSYLLDW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |