C14H18ClNO2 — CID 43796611
1-(3-chlorophenyl)-2-(2-ethylmorpholin-4-yl)ethanone (PubChem CID 43796611) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(2-ethylmorpholin-4-yl)ethanone.
| Compound Name | 1-(3-chlorophenyl)-2-(2-ethylmorpholin-4-yl)ethanone |
|---|---|
| PubChem CID | 43796611 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(2-ethylmorpholin-4-yl)ethanone |
| SMILES | CCC1CN(CC(=O)c2cccc(Cl)c2)CCO1 |
| InChI | InChI=1S/C14H18ClNO2/c1-2-13-9-16(6-7-18-13)10-14(17)11-4-3-5-12(15)8-11/h3-5,8,13H,2,6-7,9-10H2,1H3 |
| InChIKey | KRXBLCRBHQJCBC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |