C17H24N2O3 — CID 110631539
N-[[1-(hydroxymethyl)cyclohexyl]methyl]-4-oxo-4-pyridin-3-ylbutanamide (PubChem CID 110631539) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[[1-(hydroxymethyl)cyclohexyl]methyl]-4-oxo-4-pyridin-3-ylbutanamide.
| Compound Name | N-[[1-(hydroxymethyl)cyclohexyl]methyl]-4-oxo-4-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 110631539 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-[[1-(hydroxymethyl)cyclohexyl]methyl]-4-oxo-4-pyridin-3-ylbutanamide |
| SMILES | O=C(CCC(=O)c1cccnc1)NCC1(CO)CCCCC1 |
| InChI | InChI=1S/C17H24N2O3/c20-13-17(8-2-1-3-9-17)12-19-16(22)7-6-15(21)14-5-4-10-18-11-14/h4-5,10-11,20H,1-3,6-9,12-13H2,(H,19,22) |
| InChIKey | GIBXZYTYGCIOEM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |