C17H22ClNO4 — CID 110310297
4-(4-chlorophenyl)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]-4-oxobutanamide (PubChem CID 110310297) has the molecular formula C17H22ClNO4 and a molecular weight of 339.82 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]-4-oxobutanamide.
| Compound Name | 4-(4-chlorophenyl)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 110310297 |
| Molecular Formula | C17H22ClNO4 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc(Cl)cc1)NCC1(CO)CCOCC1 |
| InChI | InChI=1S/C17H22ClNO4/c18-14-3-1-13(2-4-14)15(21)5-6-16(22)19-11-17(12-20)7-9-23-10-8-17/h1-4,20H,5-12H2,(H,19,22) |
| InChIKey | UJDLMBDRDPXWHI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |