C19H28ClNO3 — CID 110310285
3-(4-chlorophenyl)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]-4-methylpentanamide (PubChem CID 110310285) has the molecular formula C19H28ClNO3 and a molecular weight of 353.89 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]-4-methylpentanamide.
| Compound Name | 3-(4-chlorophenyl)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 110310285 |
| Molecular Formula | C19H28ClNO3 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]-4-methylpentanamide |
| SMILES | CC(C)C(CC(=O)NCC1(CO)CCOCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H28ClNO3/c1-14(2)17(15-3-5-16(20)6-4-15)11-18(23)21-12-19(13-22)7-9-24-10-8-19/h3-6,14,17,22H,7-13H2,1-2H3,(H,21,23) |
| InChIKey | NRWJLGYHXVVMEE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |