C17H24FNO3 — CID 110310309
3-(4-fluorophenyl)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]-2-methylpropanamide (PubChem CID 110310309) has the molecular formula C17H24FNO3 and a molecular weight of 309.38 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]-2-methylpropanamide.
| Compound Name | 3-(4-fluorophenyl)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 110310309 |
| Molecular Formula | C17H24FNO3 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]-2-methylpropanamide |
| SMILES | CC(Cc1ccc(F)cc1)C(=O)NCC1(CO)CCOCC1 |
| InChI | InChI=1S/C17H24FNO3/c1-13(10-14-2-4-15(18)5-3-14)16(21)19-11-17(12-20)6-8-22-9-7-17/h2-5,13,20H,6-12H2,1H3,(H,19,21) |
| InChIKey | DLRHXJNICJTELI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |