C13H18FNO3S — CID 110357206
3-(4-fluorophenyl)-2-methyl-N-(2-methylsulfonylethyl)propanamide (PubChem CID 110357206) has the molecular formula C13H18FNO3S and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-methyl-N-(2-methylsulfonylethyl)propanamide.
| Compound Name | 3-(4-fluorophenyl)-2-methyl-N-(2-methylsulfonylethyl)propanamide |
|---|---|
| PubChem CID | 110357206 |
| Molecular Formula | C13H18FNO3S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 3-(4-fluorophenyl)-2-methyl-N-(2-methylsulfonylethyl)propanamide |
| SMILES | CC(Cc1ccc(F)cc1)C(=O)NCCS(C)(=O)=O |
| InChI | InChI=1S/C13H18FNO3S/c1-10(9-11-3-5-12(14)6-4-11)13(16)15-7-8-19(2,17)18/h3-6,10H,7-9H2,1-2H3,(H,15,16) |
| InChIKey | ZSSRVPWQCMQCQZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |