C17H26FNO3S — CID 110355296
4-ethyl-3-(4-fluorophenyl)-N-(2-methylsulfonylethyl)hexanamide (PubChem CID 110355296) has the molecular formula C17H26FNO3S and a molecular weight of 343.46 g/mol. Its IUPAC name is 4-ethyl-3-(4-fluorophenyl)-N-(2-methylsulfonylethyl)hexanamide.
| Compound Name | 4-ethyl-3-(4-fluorophenyl)-N-(2-methylsulfonylethyl)hexanamide |
|---|---|
| PubChem CID | 110355296 |
| Molecular Formula | C17H26FNO3S |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 4-ethyl-3-(4-fluorophenyl)-N-(2-methylsulfonylethyl)hexanamide |
| SMILES | CCC(CC)C(CC(=O)NCCS(C)(=O)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H26FNO3S/c1-4-13(5-2)16(14-6-8-15(18)9-7-14)12-17(20)19-10-11-23(3,21)22/h6-9,13,16H,4-5,10-12H2,1-3H3,(H,19,20) |
| InChIKey | NXDXEDNRUYNCLG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |