C15H22BrNO3S — CID 110355279
3-(4-bromophenyl)-4-methyl-N-(2-methylsulfonylethyl)pentanamide (PubChem CID 110355279) has the molecular formula C15H22BrNO3S and a molecular weight of 376.32 g/mol. Its IUPAC name is 3-(4-bromophenyl)-4-methyl-N-(2-methylsulfonylethyl)pentanamide.
| Compound Name | 3-(4-bromophenyl)-4-methyl-N-(2-methylsulfonylethyl)pentanamide |
|---|---|
| PubChem CID | 110355279 |
| Molecular Formula | C15H22BrNO3S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 3-(4-bromophenyl)-4-methyl-N-(2-methylsulfonylethyl)pentanamide |
| SMILES | CC(C)C(CC(=O)NCCS(C)(=O)=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H22BrNO3S/c1-11(2)14(12-4-6-13(16)7-5-12)10-15(18)17-8-9-21(3,19)20/h4-7,11,14H,8-10H2,1-3H3,(H,17,18) |
| InChIKey | FQOXVKJMVCENME-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |