C14H21FN2O3S — CID 110354796
3-(4-fluorophenyl)-N-[2-(methylsulfamoyl)ethyl]pentanamide (PubChem CID 110354796) has the molecular formula C14H21FN2O3S and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[2-(methylsulfamoyl)ethyl]pentanamide.
| Compound Name | 3-(4-fluorophenyl)-N-[2-(methylsulfamoyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 110354796 |
| Molecular Formula | C14H21FN2O3S |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[2-(methylsulfamoyl)ethyl]pentanamide |
| SMILES | CCC(CC(=O)NCCS(=O)(=O)NC)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H21FN2O3S/c1-3-11(12-4-6-13(15)7-5-12)10-14(18)17-8-9-21(19,20)16-2/h4-7,11,16H,3,8-10H2,1-2H3,(H,17,18) |
| InChIKey | ZUDMVHUAOBGAOF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |