C18H27FN2O3S — CID 110354814
3-cyclohexyl-3-(4-fluorophenyl)-N-[2-(methylsulfamoyl)ethyl]propanamide (PubChem CID 110354814) has the molecular formula C18H27FN2O3S and a molecular weight of 370.49 g/mol. Its IUPAC name is 3-cyclohexyl-3-(4-fluorophenyl)-N-[2-(methylsulfamoyl)ethyl]propanamide.
| Compound Name | 3-cyclohexyl-3-(4-fluorophenyl)-N-[2-(methylsulfamoyl)ethyl]propanamide |
|---|---|
| PubChem CID | 110354814 |
| Molecular Formula | C18H27FN2O3S |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 3-cyclohexyl-3-(4-fluorophenyl)-N-[2-(methylsulfamoyl)ethyl]propanamide |
| SMILES | CNS(=O)(=O)CCNC(=O)CC(c1ccc(F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C18H27FN2O3S/c1-20-25(23,24)12-11-21-18(22)13-17(14-5-3-2-4-6-14)15-7-9-16(19)10-8-15/h7-10,14,17,20H,2-6,11-13H2,1H3,(H,21,22) |
| InChIKey | USBCAAQKDIMWGI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |