C17H24ClNO3S — CID 110611742
N-[2-(4-chlorophenyl)-2-cyclopentylethyl]-3-methylsulfonylpropanamide (PubChem CID 110611742) has the molecular formula C17H24ClNO3S and a molecular weight of 357.90 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-cyclopentylethyl]-3-methylsulfonylpropanamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-cyclopentylethyl]-3-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 110611742 |
| Molecular Formula | C17H24ClNO3S |
| Molecular Weight | 357.90 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-cyclopentylethyl]-3-methylsulfonylpropanamide |
| SMILES | CS(=O)(=O)CCC(=O)NCC(c1ccc(Cl)cc1)C1CCCC1 |
| InChI | InChI=1S/C17H24ClNO3S/c1-23(21,22)11-10-17(20)19-12-16(13-4-2-3-5-13)14-6-8-15(18)9-7-14/h6-9,13,16H,2-5,10-12H2,1H3,(H,19,20) |
| InChIKey | JGFUJTYEXVNUDR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.90 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |