C15H20ClNO3S — CID 5058061
3-[(4-chlorophenyl)methylsulfonyl]-N-cyclopentylpropanamide (PubChem CID 5058061) has the molecular formula C15H20ClNO3S and a molecular weight of 329.85 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methylsulfonyl]-N-cyclopentylpropanamide.
| Compound Name | 3-[(4-chlorophenyl)methylsulfonyl]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 5058061 |
| Molecular Formula | C15H20ClNO3S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 3-[(4-chlorophenyl)methylsulfonyl]-N-cyclopentylpropanamide |
| SMILES | O=C(CCS(=O)(=O)Cc1ccc(Cl)cc1)NC1CCCC1 |
| InChI | InChI=1S/C15H20ClNO3S/c16-13-7-5-12(6-8-13)11-21(19,20)10-9-15(18)17-14-3-1-2-4-14/h5-8,14H,1-4,9-11H2,(H,17,18) |
| InChIKey | DAQXSWWIOKRFNO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |